C23H15F7N2O6 — CID 132957395
3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide (PubChem CID 132957395) has the molecular formula C23H15F7N2O6 and a molecular weight of 548.37 g/mol. Its IUPAC name is 3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide.
| Compound Name | 3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 132957395 |
| Molecular Formula | C23H15F7N2O6 |
| Molecular Weight | 548.37 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | 3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(OC(F)(F)C(F)F)cc2)ccc1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H15F7N2O6/c1-36-19-10-12(20(33)31-14-4-6-15(7-5-14)38-23(29,30)21(24)25)2-8-18(19)37-17-9-3-13(22(26,27)28)11-16(17)32(34)35/h2-11,21H,1H3,(H,31,33) |
| InChIKey | SFUCKQTZNOAQIB-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.37 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|