C22H17F3N2O6 — CID 1255593
3-methoxy-N-(4-methoxyphenyl)-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide (PubChem CID 1255593) has the molecular formula C22H17F3N2O6 and a molecular weight of 462.38 g/mol. Its IUPAC name is 3-methoxy-N-(4-methoxyphenyl)-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide.
| Compound Name | 3-methoxy-N-(4-methoxyphenyl)-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide |
|---|---|
| PubChem CID | 1255593 |
| Molecular Formula | C22H17F3N2O6 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 3-methoxy-N-(4-methoxyphenyl)-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(OC)c2)cc1 |
| InChI | InChI=1S/C22H17F3N2O6/c1-31-16-7-5-15(6-8-16)26-21(28)13-3-9-19(20(11-13)32-2)33-18-10-4-14(22(23,24)25)12-17(18)27(29)30/h3-12H,1-2H3,(H,26,28) |
| InChIKey | MPIVJSWNYSPWGW-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|