C21H14ClF3N2O5 — CID 1340542
4-chloro-N-[2-(4-methoxyphenoxy)-5-(trifluoromethyl)phenyl]-3-nitrobenzamide (PubChem CID 1340542) has the molecular formula C21H14ClF3N2O5 and a molecular weight of 466.80 g/mol. Its IUPAC name is 4-chloro-N-[2-(4-methoxyphenoxy)-5-(trifluoromethyl)phenyl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[2-(4-methoxyphenoxy)-5-(trifluoromethyl)phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 1340542 |
| Molecular Formula | C21H14ClF3N2O5 |
| Molecular Weight | 466.80 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 4-chloro-N-[2-(4-methoxyphenoxy)-5-(trifluoromethyl)phenyl]-3-nitrobenzamide |
| SMILES | COc1ccc(Oc2ccc(C(F)(F)F)cc2NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C21H14ClF3N2O5/c1-31-14-4-6-15(7-5-14)32-19-9-3-13(21(23,24)25)11-17(19)26-20(28)12-2-8-16(22)18(10-12)27(29)30/h2-11H,1H3,(H,26,28) |
| InChIKey | FEAXWGCGDSKCRC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.80 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|