C17H10ClF7N2O4 — CID 132827479
N-[2-chloro-5-(trifluoromethyl)phenyl]-3-nitro-4-(2,2,3,3-tetrafluoropropoxy)benzamide (PubChem CID 132827479) has the molecular formula C17H10ClF7N2O4 and a molecular weight of 474.72 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-3-nitro-4-(2,2,3,3-tetrafluoropropoxy)benzamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-3-nitro-4-(2,2,3,3-tetrafluoropropoxy)benzamide |
|---|---|
| PubChem CID | 132827479 |
| Molecular Formula | C17H10ClF7N2O4 |
| Molecular Weight | 474.72 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-3-nitro-4-(2,2,3,3-tetrafluoropropoxy)benzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)c1ccc(OCC(F)(F)C(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H10ClF7N2O4/c18-10-3-2-9(17(23,24)25)6-11(10)26-14(28)8-1-4-13(12(5-8)27(29)30)31-7-16(21,22)15(19)20/h1-6,15H,7H2,(H,26,28) |
| InChIKey | OSFWTIJBEJOBDI-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.72 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|