C21H20F4N2O9 — CID 132835456
methyl 3,4,5-trimethoxy-2-[[3-nitro-4-(2,2,3,3-tetrafluoropropoxy)benzoyl]amino]benzoate (PubChem CID 132835456) has the molecular formula C21H20F4N2O9 and a molecular weight of 520.39 g/mol. Its IUPAC name is methyl 3,4,5-trimethoxy-2-[[3-nitro-4-(2,2,3,3-tetrafluoropropoxy)benzoyl]amino]benzoate.
| Compound Name | methyl 3,4,5-trimethoxy-2-[[3-nitro-4-(2,2,3,3-tetrafluoropropoxy)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 132835456 |
| Molecular Formula | C21H20F4N2O9 |
| Molecular Weight | 520.39 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | methyl 3,4,5-trimethoxy-2-[[3-nitro-4-(2,2,3,3-tetrafluoropropoxy)benzoyl]amino]benzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)c(OC)c1NC(=O)c1ccc(OCC(F)(F)C(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H20F4N2O9/c1-32-14-8-11(19(29)35-4)15(17(34-3)16(14)33-2)26-18(28)10-5-6-13(12(7-10)27(30)31)36-9-21(24,25)20(22)23/h5-8,20H,9H2,1-4H3,(H,26,28) |
| InChIKey | OPTFRUVKELYGGH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|