C16H10Cl2F4N2O4 — CID 5063007
4-chloro-N-[5-chloro-2-(2,2,3,3-tetrafluoropropoxy)phenyl]-3-nitrobenzamide (PubChem CID 5063007) has the molecular formula C16H10Cl2F4N2O4 and a molecular weight of 441.16 g/mol. Its IUPAC name is 4-chloro-N-[5-chloro-2-(2,2,3,3-tetrafluoropropoxy)phenyl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[5-chloro-2-(2,2,3,3-tetrafluoropropoxy)phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 5063007 |
| Molecular Formula | C16H10Cl2F4N2O4 |
| Molecular Weight | 441.16 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | 4-chloro-N-[5-chloro-2-(2,2,3,3-tetrafluoropropoxy)phenyl]-3-nitrobenzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1OCC(F)(F)C(F)F)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H10Cl2F4N2O4/c17-9-2-4-13(28-7-16(21,22)15(19)20)11(6-9)23-14(25)8-1-3-10(18)12(5-8)24(26)27/h1-6,15H,7H2,(H,23,25) |
| InChIKey | FZJDWNRMUHNIIV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.16 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|