C16H11BrClF4NO2 — CID 1247533
4-bromo-N-[5-chloro-2-(2,2,3,3-tetrafluoropropoxy)phenyl]benzamide (PubChem CID 1247533) has the molecular formula C16H11BrClF4NO2 and a molecular weight of 440.62 g/mol. Its IUPAC name is 4-bromo-N-[5-chloro-2-(2,2,3,3-tetrafluoropropoxy)phenyl]benzamide.
| Compound Name | 4-bromo-N-[5-chloro-2-(2,2,3,3-tetrafluoropropoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 1247533 |
| Molecular Formula | C16H11BrClF4NO2 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 438.96 |
| IUPAC Name | 4-bromo-N-[5-chloro-2-(2,2,3,3-tetrafluoropropoxy)phenyl]benzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1OCC(F)(F)C(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H11BrClF4NO2/c17-10-3-1-9(2-4-10)14(24)23-12-7-11(18)5-6-13(12)25-8-16(21,22)15(19)20/h1-7,15H,8H2,(H,23,24) |
| InChIKey | RULUFLJKINSKMQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|