C17H15F4NO2 — CID 7220942
4-methyl-N-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]benzamide (PubChem CID 7220942) has the molecular formula C17H15F4NO2 and a molecular weight of 341.30 g/mol. Its IUPAC name is 4-methyl-N-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]benzamide.
| Compound Name | 4-methyl-N-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 7220942 |
| Molecular Formula | C17H15F4NO2 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 4-methyl-N-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2OCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C17H15F4NO2/c1-11-6-8-12(9-7-11)15(23)22-13-4-2-3-5-14(13)24-10-17(20,21)16(18)19/h2-9,16H,10H2,1H3,(H,22,23) |
| InChIKey | MGFNLRRZAYINGZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|