C16H15F2NO4S — CID 2590897
4-(difluoromethylsulfonyl)-N-(2-ethoxyphenyl)benzamide (PubChem CID 2590897) has the molecular formula C16H15F2NO4S and a molecular weight of 355.36 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-(2-ethoxyphenyl)benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-(2-ethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 2590897 |
| Molecular Formula | C16H15F2NO4S |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-(2-ethoxyphenyl)benzamide |
| SMILES | CCOc1ccccc1NC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C16H15F2NO4S/c1-2-23-14-6-4-3-5-13(14)19-15(20)11-7-9-12(10-8-11)24(21,22)16(17)18/h3-10,16H,2H2,1H3,(H,19,20) |
| InChIKey | PKIIVEQBLKHZTR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |