C17H17F2NO4S — CID 86821736
4-(difluoromethylsulfonyl)-N-[2-(ethoxymethyl)phenyl]benzamide (PubChem CID 86821736) has the molecular formula C17H17F2NO4S and a molecular weight of 369.39 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[2-(ethoxymethyl)phenyl]benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[2-(ethoxymethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 86821736 |
| Molecular Formula | C17H17F2NO4S |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[2-(ethoxymethyl)phenyl]benzamide |
| SMILES | CCOCc1ccccc1NC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C17H17F2NO4S/c1-2-24-11-13-5-3-4-6-15(13)20-16(21)12-7-9-14(10-8-12)25(22,23)17(18)19/h3-10,17H,2,11H2,1H3,(H,20,21) |
| InChIKey | QJOKBHNDVQRARJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |