C19H21F2NO4S — CID 55584493
4-(difluoromethylsulfonyl)-N-[[2-(propan-2-yloxymethyl)phenyl]methyl]benzamide (PubChem CID 55584493) has the molecular formula C19H21F2NO4S and a molecular weight of 397.44 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[[2-(propan-2-yloxymethyl)phenyl]methyl]benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[[2-(propan-2-yloxymethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55584493 |
| Molecular Formula | C19H21F2NO4S |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[[2-(propan-2-yloxymethyl)phenyl]methyl]benzamide |
| SMILES | CC(C)OCc1ccccc1CNC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C19H21F2NO4S/c1-13(2)26-12-16-6-4-3-5-15(16)11-22-18(23)14-7-9-17(10-8-14)27(24,25)19(20)21/h3-10,13,19H,11-12H2,1-2H3,(H,22,23) |
| InChIKey | QREUUYWXWJUXST-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |