C17H13F2NO3S — CID 51326569
4-(difluoromethylsulfonyl)-N-(3-phenylprop-2-ynyl)benzamide (PubChem CID 51326569) has the molecular formula C17H13F2NO3S and a molecular weight of 349.36 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-(3-phenylprop-2-ynyl)benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-(3-phenylprop-2-ynyl)benzamide |
|---|---|
| PubChem CID | 51326569 |
| Molecular Formula | C17H13F2NO3S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-(3-phenylprop-2-ynyl)benzamide |
| SMILES | O=C(NCC#Cc1ccccc1)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C17H13F2NO3S/c18-17(19)24(22,23)15-10-8-14(9-11-15)16(21)20-12-4-7-13-5-2-1-3-6-13/h1-3,5-6,8-11,17H,12H2,(H,20,21) |
| InChIKey | YHTZZTOBSUCOPG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|