C17H15F2NO5S — CID 9292250
(2R)-2-[[4-(difluoromethylsulfonyl)benzoyl]amino]-3-phenylpropanoic acid (PubChem CID 9292250) has the molecular formula C17H15F2NO5S and a molecular weight of 383.37 g/mol. Its IUPAC name is (2R)-2-[[4-(difluoromethylsulfonyl)benzoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[4-(difluoromethylsulfonyl)benzoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 9292250 |
| Molecular Formula | C17H15F2NO5S |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | (2R)-2-[[4-(difluoromethylsulfonyl)benzoyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(N[C@H](Cc1ccccc1)C(=O)O)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C17H15F2NO5S/c18-17(19)26(24,25)13-8-6-12(7-9-13)15(21)20-14(16(22)23)10-11-4-2-1-3-5-11/h1-9,14,17H,10H2,(H,20,21)(H,22,23)/t14-/m1/s1 |
| InChIKey | LWBNDXDBRRANHE-CQSZACIVSA-N |
| XLogP | 2.11 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |