C20H14ClF2NO4S — CID 24514279
N-[2-(2-chlorophenoxy)phenyl]-4-(difluoromethylsulfonyl)benzamide (PubChem CID 24514279) has the molecular formula C20H14ClF2NO4S and a molecular weight of 437.85 g/mol. Its IUPAC name is N-[2-(2-chlorophenoxy)phenyl]-4-(difluoromethylsulfonyl)benzamide.
| Compound Name | N-[2-(2-chlorophenoxy)phenyl]-4-(difluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 24514279 |
| Molecular Formula | C20H14ClF2NO4S |
| Molecular Weight | 437.85 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | N-[2-(2-chlorophenoxy)phenyl]-4-(difluoromethylsulfonyl)benzamide |
| SMILES | O=C(Nc1ccccc1Oc1ccccc1Cl)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C20H14ClF2NO4S/c21-15-5-1-3-7-17(15)28-18-8-4-2-6-16(18)24-19(25)13-9-11-14(12-10-13)29(26,27)20(22)23/h1-12,20H,(H,24,25) |
| InChIKey | VKGAFDQCTYAQBT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.85 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |