C14H9Cl2F2NO3S — CID 8916740
3,4-dichloro-N-[2-(difluoromethylsulfonyl)phenyl]benzamide (PubChem CID 8916740) has the molecular formula C14H9Cl2F2NO3S and a molecular weight of 380.20 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(difluoromethylsulfonyl)phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-(difluoromethylsulfonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 8916740 |
| Molecular Formula | C14H9Cl2F2NO3S |
| Molecular Weight | 380.20 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | 3,4-dichloro-N-[2-(difluoromethylsulfonyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1S(=O)(=O)C(F)F)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H9Cl2F2NO3S/c15-9-6-5-8(7-10(9)16)13(20)19-11-3-1-2-4-12(11)23(21,22)14(17)18/h1-7,14H,(H,19,20) |
| InChIKey | VFFUMSJZQUISKA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.20 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |