C13H9Cl2NO5S — CID 175675404
2-[(3,5-dichloro-4-hydroxybenzoyl)amino]benzenesulfonic acid (PubChem CID 175675404) has the molecular formula C13H9Cl2NO5S and a molecular weight of 362.19 g/mol. Its IUPAC name is 2-[(3,5-dichloro-4-hydroxybenzoyl)amino]benzenesulfonic acid.
| Compound Name | 2-[(3,5-dichloro-4-hydroxybenzoyl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 175675404 |
| Molecular Formula | C13H9Cl2NO5S |
| Molecular Weight | 362.19 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | 2-[(3,5-dichloro-4-hydroxybenzoyl)amino]benzenesulfonic acid |
| SMILES | O=C(Nc1ccccc1S(=O)(=O)O)c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C13H9Cl2NO5S/c14-8-5-7(6-9(15)12(8)17)13(18)16-10-3-1-2-4-11(10)22(19,20)21/h1-6,17H,(H,16,18)(H,19,20,21) |
| InChIKey | CLUYHLADSSYMCG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.19 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|