C16H16F2N2O6S2 — CID 55406097
N-[2-(difluoromethylsulfonyl)phenyl]-4-[methoxy(methyl)sulfamoyl]benzamide (PubChem CID 55406097) has the molecular formula C16H16F2N2O6S2 and a molecular weight of 434.44 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfonyl)phenyl]-4-[methoxy(methyl)sulfamoyl]benzamide.
| Compound Name | N-[2-(difluoromethylsulfonyl)phenyl]-4-[methoxy(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55406097 |
| Molecular Formula | C16H16F2N2O6S2 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | N-[2-(difluoromethylsulfonyl)phenyl]-4-[methoxy(methyl)sulfamoyl]benzamide |
| SMILES | CON(C)S(=O)(=O)c1ccc(C(=O)Nc2ccccc2S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C16H16F2N2O6S2/c1-20(26-2)28(24,25)12-9-7-11(8-10-12)15(21)19-13-5-3-4-6-14(13)27(22,23)16(17)18/h3-10,16H,1-2H3,(H,19,21) |
| InChIKey | HBSZZVBJUAPTSX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|