C20H25N3O5S — CID 9327451
4-[[(4-tert-butylbenzoyl)amino]carbamoyl]-N-methoxy-N-methylbenzenesulfonamide (PubChem CID 9327451) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is 4-[[(4-tert-butylbenzoyl)amino]carbamoyl]-N-methoxy-N-methylbenzenesulfonamide.
| Compound Name | 4-[[(4-tert-butylbenzoyl)amino]carbamoyl]-N-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 9327451 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 4-[[(4-tert-butylbenzoyl)amino]carbamoyl]-N-methoxy-N-methylbenzenesulfonamide |
| SMILES | CON(C)S(=O)(=O)c1ccc(C(=O)NNC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H25N3O5S/c1-20(2,3)16-10-6-14(7-11-16)18(24)21-22-19(25)15-8-12-17(13-9-15)29(26,27)23(4)28-5/h6-13H,1-5H3,(H,21,24)(H,22,25) |
| InChIKey | DPEJLEDKXYBRQV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|