C14H22N4O4S — CID 9205648
4-[methoxy(methyl)sulfamoyl]-N-(4-methylpiperazin-1-yl)benzamide (PubChem CID 9205648) has the molecular formula C14H22N4O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is 4-[methoxy(methyl)sulfamoyl]-N-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | 4-[methoxy(methyl)sulfamoyl]-N-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 9205648 |
| Molecular Formula | C14H22N4O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 4-[methoxy(methyl)sulfamoyl]-N-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CON(C)S(=O)(=O)c1ccc(C(=O)NN2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C14H22N4O4S/c1-16-8-10-18(11-9-16)15-14(19)12-4-6-13(7-5-12)23(20,21)17(2)22-3/h4-7H,8-11H2,1-3H3,(H,15,19) |
| InChIKey | XXYIMDFILUMQGS-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|