C17H19N3O5S — CID 9224243
N-methoxy-N-methyl-4-[[(2-methylbenzoyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 9224243) has the molecular formula C17H19N3O5S and a molecular weight of 377.42 g/mol. Its IUPAC name is N-methoxy-N-methyl-4-[[(2-methylbenzoyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-methoxy-N-methyl-4-[[(2-methylbenzoyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9224243 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-methoxy-N-methyl-4-[[(2-methylbenzoyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | CON(C)S(=O)(=O)c1ccc(C(=O)NNC(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C17H19N3O5S/c1-12-6-4-5-7-15(12)17(22)19-18-16(21)13-8-10-14(11-9-13)26(23,24)20(2)25-3/h4-11H,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | BDGLIZCCZVMASO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|