C17H20N2O4S — CID 60601161
N-[4-[methoxy(methyl)sulfamoyl]phenyl]-2,4-dimethylbenzamide (PubChem CID 60601161) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is N-[4-[methoxy(methyl)sulfamoyl]phenyl]-2,4-dimethylbenzamide.
| Compound Name | N-[4-[methoxy(methyl)sulfamoyl]phenyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 60601161 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[4-[methoxy(methyl)sulfamoyl]phenyl]-2,4-dimethylbenzamide |
| SMILES | CON(C)S(=O)(=O)c1ccc(NC(=O)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C17H20N2O4S/c1-12-5-10-16(13(2)11-12)17(20)18-14-6-8-15(9-7-14)24(21,22)19(3)23-4/h5-11H,1-4H3,(H,18,20) |
| InChIKey | KQWSTZIRLBDEEW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|