C17H20ClN3O6S2 — CID 55983949
4-chloro-N-[2-(dimethylsulfamoyl)phenyl]-3-[methoxy(methyl)sulfamoyl]benzamide (PubChem CID 55983949) has the molecular formula C17H20ClN3O6S2 and a molecular weight of 461.95 g/mol. Its IUPAC name is 4-chloro-N-[2-(dimethylsulfamoyl)phenyl]-3-[methoxy(methyl)sulfamoyl]benzamide.
| Compound Name | 4-chloro-N-[2-(dimethylsulfamoyl)phenyl]-3-[methoxy(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55983949 |
| Molecular Formula | C17H20ClN3O6S2 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 4-chloro-N-[2-(dimethylsulfamoyl)phenyl]-3-[methoxy(methyl)sulfamoyl]benzamide |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)Nc2ccccc2S(=O)(=O)N(C)C)ccc1Cl |
| InChI | InChI=1S/C17H20ClN3O6S2/c1-20(2)28(23,24)15-8-6-5-7-14(15)19-17(22)12-9-10-13(18)16(11-12)29(25,26)21(3)27-4/h5-11H,1-4H3,(H,19,22) |
| InChIKey | AVRGAHJBGQSAKQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|