C17H18ClN3O5S — CID 9158529
4-chloro-3-[methoxy(methyl)sulfamoyl]-N-[4-(methylcarbamoyl)phenyl]benzamide (PubChem CID 9158529) has the molecular formula C17H18ClN3O5S and a molecular weight of 411.87 g/mol. Its IUPAC name is 4-chloro-3-[methoxy(methyl)sulfamoyl]-N-[4-(methylcarbamoyl)phenyl]benzamide.
| Compound Name | 4-chloro-3-[methoxy(methyl)sulfamoyl]-N-[4-(methylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 9158529 |
| Molecular Formula | C17H18ClN3O5S |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 4-chloro-3-[methoxy(methyl)sulfamoyl]-N-[4-(methylcarbamoyl)phenyl]benzamide |
| SMILES | CNC(=O)c1ccc(NC(=O)c2ccc(Cl)c(S(=O)(=O)N(C)OC)c2)cc1 |
| InChI | InChI=1S/C17H18ClN3O5S/c1-19-16(22)11-4-7-13(8-5-11)20-17(23)12-6-9-14(18)15(10-12)27(24,25)21(2)26-3/h4-10H,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | WHZIVGNSALUMME-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|