C16H16BrClN2O4S — CID 27667536
N-(4-bromo-3-methylphenyl)-4-chloro-3-[methoxy(methyl)sulfamoyl]benzamide (PubChem CID 27667536) has the molecular formula C16H16BrClN2O4S and a molecular weight of 447.74 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-4-chloro-3-[methoxy(methyl)sulfamoyl]benzamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-4-chloro-3-[methoxy(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 27667536 |
| Molecular Formula | C16H16BrClN2O4S |
| Molecular Weight | 447.74 g/mol |
| Exact Mass | 445.97 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-4-chloro-3-[methoxy(methyl)sulfamoyl]benzamide |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)Nc2ccc(Br)c(C)c2)ccc1Cl |
| InChI | InChI=1S/C16H16BrClN2O4S/c1-10-8-12(5-6-13(10)17)19-16(21)11-4-7-14(18)15(9-11)25(22,23)20(2)24-3/h4-9H,1-3H3,(H,19,21) |
| InChIKey | FGJQECJWPLLYHB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.74 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|