C19H21ClN4O5S — CID 55532770
4-chloro-N-[4-(cyclopropylcarbamoylamino)phenyl]-3-[methoxy(methyl)sulfamoyl]benzamide (PubChem CID 55532770) has the molecular formula C19H21ClN4O5S and a molecular weight of 452.92 g/mol. Its IUPAC name is 4-chloro-N-[4-(cyclopropylcarbamoylamino)phenyl]-3-[methoxy(methyl)sulfamoyl]benzamide.
| Compound Name | 4-chloro-N-[4-(cyclopropylcarbamoylamino)phenyl]-3-[methoxy(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55532770 |
| Molecular Formula | C19H21ClN4O5S |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 4-chloro-N-[4-(cyclopropylcarbamoylamino)phenyl]-3-[methoxy(methyl)sulfamoyl]benzamide |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)Nc2ccc(NC(=O)NC3CC3)cc2)ccc1Cl |
| InChI | InChI=1S/C19H21ClN4O5S/c1-24(29-2)30(27,28)17-11-12(3-10-16(17)20)18(25)21-13-4-6-14(7-5-13)22-19(26)23-15-8-9-15/h3-7,10-11,15H,8-9H2,1-2H3,(H,21,25)(H2,22,23,26) |
| InChIKey | VXTOCQVOBJKKSP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|