C15H14ClIN2O4S — CID 27666744
4-chloro-N-(2-iodophenyl)-3-[methoxy(methyl)sulfamoyl]benzamide (PubChem CID 27666744) has the molecular formula C15H14ClIN2O4S and a molecular weight of 480.71 g/mol. Its IUPAC name is 4-chloro-N-(2-iodophenyl)-3-[methoxy(methyl)sulfamoyl]benzamide.
| Compound Name | 4-chloro-N-(2-iodophenyl)-3-[methoxy(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 27666744 |
| Molecular Formula | C15H14ClIN2O4S |
| Molecular Weight | 480.71 g/mol |
| Exact Mass | 479.94 |
| IUPAC Name | 4-chloro-N-(2-iodophenyl)-3-[methoxy(methyl)sulfamoyl]benzamide |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)Nc2ccccc2I)ccc1Cl |
| InChI | InChI=1S/C15H14ClIN2O4S/c1-19(23-2)24(21,22)14-9-10(7-8-11(14)16)15(20)18-13-6-4-3-5-12(13)17/h3-9H,1-2H3,(H,18,20) |
| InChIKey | GCLITAVQRLVLRY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.71 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|