C17H17Cl2N3O5S — CID 55835625
4-chloro-N-[4-chloro-3-(methylcarbamoyl)phenyl]-3-[methoxy(methyl)sulfamoyl]benzamide (PubChem CID 55835625) has the molecular formula C17H17Cl2N3O5S and a molecular weight of 446.31 g/mol. Its IUPAC name is 4-chloro-N-[4-chloro-3-(methylcarbamoyl)phenyl]-3-[methoxy(methyl)sulfamoyl]benzamide.
| Compound Name | 4-chloro-N-[4-chloro-3-(methylcarbamoyl)phenyl]-3-[methoxy(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55835625 |
| Molecular Formula | C17H17Cl2N3O5S |
| Molecular Weight | 446.31 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | 4-chloro-N-[4-chloro-3-(methylcarbamoyl)phenyl]-3-[methoxy(methyl)sulfamoyl]benzamide |
| SMILES | CNC(=O)c1cc(NC(=O)c2ccc(Cl)c(S(=O)(=O)N(C)OC)c2)ccc1Cl |
| InChI | InChI=1S/C17H17Cl2N3O5S/c1-20-17(24)12-9-11(5-7-13(12)18)21-16(23)10-4-6-14(19)15(8-10)28(25,26)22(2)27-3/h4-9H,1-3H3,(H,20,24)(H,21,23) |
| InChIKey | RTZWTBGKKVLMEL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|