C21H21ClN4O4S2 — CID 30900607
4-chloro-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-3-[methoxy(methyl)sulfamoyl]benzamide (PubChem CID 30900607) has the molecular formula C21H21ClN4O4S2 and a molecular weight of 493.01 g/mol. Its IUPAC name is 4-chloro-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-3-[methoxy(methyl)sulfamoyl]benzamide.
| Compound Name | 4-chloro-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-3-[methoxy(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 30900607 |
| Molecular Formula | C21H21ClN4O4S2 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | 4-chloro-N-[4-(4,6-dimethylpyrimidin-2-yl)sulfanylphenyl]-3-[methoxy(methyl)sulfamoyl]benzamide |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)Nc2ccc(Sc3nc(C)cc(C)n3)cc2)ccc1Cl |
| InChI | InChI=1S/C21H21ClN4O4S2/c1-13-11-14(2)24-21(23-13)31-17-8-6-16(7-9-17)25-20(27)15-5-10-18(22)19(12-15)32(28,29)26(3)30-4/h5-12H,1-4H3,(H,25,27) |
| InChIKey | OBUMWTCAWWFSJL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|