C12H15F2NO3S — CID 60630209
N-[2-(difluoromethylsulfonyl)phenyl]-2,2-dimethylpropanamide (PubChem CID 60630209) has the molecular formula C12H15F2NO3S and a molecular weight of 291.32 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfonyl)phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-(difluoromethylsulfonyl)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 60630209 |
| Molecular Formula | C12H15F2NO3S |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N-[2-(difluoromethylsulfonyl)phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C12H15F2NO3S/c1-12(2,3)10(16)15-8-6-4-5-7-9(8)19(17,18)11(13)14/h4-7,11H,1-3H3,(H,15,16) |
| InChIKey | RRFAGSLBKZGDJE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |