C13H18F2N2O3S — CID 60846853
2-amino-N-[2-(difluoromethylsulfonyl)phenyl]-2-methylpentanamide (PubChem CID 60846853) has the molecular formula C13H18F2N2O3S and a molecular weight of 320.36 g/mol. Its IUPAC name is 2-amino-N-[2-(difluoromethylsulfonyl)phenyl]-2-methylpentanamide.
| Compound Name | 2-amino-N-[2-(difluoromethylsulfonyl)phenyl]-2-methylpentanamide |
|---|---|
| PubChem CID | 60846853 |
| Molecular Formula | C13H18F2N2O3S |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-amino-N-[2-(difluoromethylsulfonyl)phenyl]-2-methylpentanamide |
| SMILES | CCCC(C)(N)C(=O)Nc1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C13H18F2N2O3S/c1-3-8-13(2,16)11(18)17-9-6-4-5-7-10(9)21(19,20)12(14)15/h4-7,12H,3,8,16H2,1-2H3,(H,17,18) |
| InChIKey | SDLVTHRBLWXGCD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |