C13H9Cl2NO3S — CID 47108670
N-(benzenesulfonyl)-3,4-dichlorobenzamide (PubChem CID 47108670) has the molecular formula C13H9Cl2NO3S and a molecular weight of 330.19 g/mol. Its IUPAC name is N-(benzenesulfonyl)-3,4-dichlorobenzamide.
| Compound Name | N-(benzenesulfonyl)-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 47108670 |
| Molecular Formula | C13H9Cl2NO3S |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | N-(benzenesulfonyl)-3,4-dichlorobenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H9Cl2NO3S/c14-11-7-6-9(8-12(11)15)13(17)16-20(18,19)10-4-2-1-3-5-10/h1-8H,(H,16,17) |
| InChIKey | TYWATGXEBFMKLB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |