C12H8Cl2N2O3S — CID 134393571
N-(benzenesulfonyl)-2,6-dichloropyridine-3-carboxamide (PubChem CID 134393571) has the molecular formula C12H8Cl2N2O3S and a molecular weight of 331.18 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2,6-dichloropyridine-3-carboxamide.
| Compound Name | N-(benzenesulfonyl)-2,6-dichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 134393571 |
| Molecular Formula | C12H8Cl2N2O3S |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | N-(benzenesulfonyl)-2,6-dichloropyridine-3-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccccc1)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C12H8Cl2N2O3S/c13-10-7-6-9(11(14)15-10)12(17)16-20(18,19)8-4-2-1-3-5-8/h1-7H,(H,16,17) |
| InChIKey | XMPUJGJSKZBKEU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|