C16H13ClN4O4S — CID 134398714
N-(benzenesulfonyl)-2-chloro-6-(3-methoxypyrazol-1-yl)pyridine-3-carboxamide (PubChem CID 134398714) has the molecular formula C16H13ClN4O4S and a molecular weight of 392.82 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2-chloro-6-(3-methoxypyrazol-1-yl)pyridine-3-carboxamide.
| Compound Name | N-(benzenesulfonyl)-2-chloro-6-(3-methoxypyrazol-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134398714 |
| Molecular Formula | C16H13ClN4O4S |
| Molecular Weight | 392.82 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | N-(benzenesulfonyl)-2-chloro-6-(3-methoxypyrazol-1-yl)pyridine-3-carboxamide |
| SMILES | COc1ccn(-c2ccc(C(=O)NS(=O)(=O)c3ccccc3)c(Cl)n2)n1 |
| InChI | InChI=1S/C16H13ClN4O4S/c1-25-14-9-10-21(19-14)13-8-7-12(15(17)18-13)16(22)20-26(23,24)11-5-3-2-4-6-11/h2-10H,1H3,(H,20,22) |
| InChIKey | IANBRANAHDXMBE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.82 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|