C24H23ClN4O4S — CID 134393481
2-chloro-6-[3-(dispiro[2.0.24.13]heptan-7-ylmethoxy)pyrazol-1-yl]-N-(2-methylphenyl)sulfonylpyridine-3-carboxamide (PubChem CID 134393481) has the molecular formula C24H23ClN4O4S and a molecular weight of 498.99 g/mol. Its IUPAC name is 2-chloro-6-[3-(dispiro[2.0.24.13]heptan-7-ylmethoxy)pyrazol-1-yl]-N-(2-methylphenyl)sulfonylpyridine-3-carboxamide.
| Compound Name | 2-chloro-6-[3-(dispiro[2.0.24.13]heptan-7-ylmethoxy)pyrazol-1-yl]-N-(2-methylphenyl)sulfonylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 134393481 |
| Molecular Formula | C24H23ClN4O4S |
| Molecular Weight | 498.99 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 2-chloro-6-[3-(dispiro[2.0.24.13]heptan-7-ylmethoxy)pyrazol-1-yl]-N-(2-methylphenyl)sulfonylpyridine-3-carboxamide |
| SMILES | Cc1ccccc1S(=O)(=O)NC(=O)c1ccc(-n2ccc(OCC3C4(CC4)C34CC4)n2)nc1Cl |
| InChI | InChI=1S/C24H23ClN4O4S/c1-15-4-2-3-5-17(15)34(31,32)28-22(30)16-6-7-19(26-21(16)25)29-13-8-20(27-29)33-14-18-23(9-10-23)24(18)11-12-24/h2-8,13,18H,9-12,14H2,1H3,(H,28,30) |
| InChIKey | NVQPMDKKUMPOAO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.99 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|