C20H27ClN6O4SSi — CID 149098371
2-chloro-N-(1,3-dimethylpyrazol-4-yl)sulfonyl-6-[3-(3-trimethylsilylpropoxy)pyrazol-1-yl]pyridine-3-carboxamide (PubChem CID 149098371) has the molecular formula C20H27ClN6O4SSi and a molecular weight of 511.08 g/mol. Its IUPAC name is 2-chloro-N-(1,3-dimethylpyrazol-4-yl)sulfonyl-6-[3-(3-trimethylsilylpropoxy)pyrazol-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(1,3-dimethylpyrazol-4-yl)sulfonyl-6-[3-(3-trimethylsilylpropoxy)pyrazol-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 149098371 |
| Molecular Formula | C20H27ClN6O4SSi |
| Molecular Weight | 511.08 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 2-chloro-N-(1,3-dimethylpyrazol-4-yl)sulfonyl-6-[3-(3-trimethylsilylpropoxy)pyrazol-1-yl]pyridine-3-carboxamide |
| SMILES | Cc1nn(C)cc1S(=O)(=O)NC(=O)c1ccc(-n2ccc(OCCC[Si](C)(C)C)n2)nc1Cl |
| InChI | InChI=1S/C20H27ClN6O4SSi/c1-14-16(13-26(2)23-14)32(29,30)25-20(28)15-7-8-17(22-19(15)21)27-10-9-18(24-27)31-11-6-12-33(3,4)5/h7-10,13H,6,11-12H2,1-5H3,(H,25,28) |
| InChIKey | QUAYKCORXDBSMP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.08 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|