C21H29ClN6O4SSi — CID 155784147
6-[3-[[tert-butyl(dimethyl)silyl]methoxy]pyrazol-1-yl]-2-chloro-N-(1,3-dimethylpyrazol-4-yl)sulfonylpyridine-3-carboxamide (PubChem CID 155784147) has the molecular formula C21H29ClN6O4SSi and a molecular weight of 525.11 g/mol. Its IUPAC name is 6-[3-[[tert-butyl(dimethyl)silyl]methoxy]pyrazol-1-yl]-2-chloro-N-(1,3-dimethylpyrazol-4-yl)sulfonylpyridine-3-carboxamide.
| Compound Name | 6-[3-[[tert-butyl(dimethyl)silyl]methoxy]pyrazol-1-yl]-2-chloro-N-(1,3-dimethylpyrazol-4-yl)sulfonylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 155784147 |
| Molecular Formula | C21H29ClN6O4SSi |
| Molecular Weight | 525.11 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 6-[3-[[tert-butyl(dimethyl)silyl]methoxy]pyrazol-1-yl]-2-chloro-N-(1,3-dimethylpyrazol-4-yl)sulfonylpyridine-3-carboxamide |
| SMILES | Cc1nn(C)cc1S(=O)(=O)NC(=O)c1ccc(-n2ccc(OC[Si](C)(C)C(C)(C)C)n2)nc1Cl |
| InChI | InChI=1S/C21H29ClN6O4SSi/c1-14-16(12-27(5)24-14)33(30,31)26-20(29)15-8-9-17(23-19(15)22)28-11-10-18(25-28)32-13-34(6,7)21(2,3)4/h8-12H,13H2,1-7H3,(H,26,29) |
| InChIKey | DASNKRTYYDIKHQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.11 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|