C19H22ClN5O4S — CID 160889351
[2-chloro-6-[3-(2,2-dimethylpropoxy)pyrazol-1-yl]-3-pyridinyl]-(1,3-dimethylpyrazol-4-yl)sulfonylmethanone (PubChem CID 160889351) has the molecular formula C19H22ClN5O4S and a molecular weight of 451.94 g/mol. Its IUPAC name is [2-chloro-6-[3-(2,2-dimethylpropoxy)pyrazol-1-yl]-3-pyridinyl]-(1,3-dimethylpyrazol-4-yl)sulfonylmethanone.
| Compound Name | [2-chloro-6-[3-(2,2-dimethylpropoxy)pyrazol-1-yl]-3-pyridinyl]-(1,3-dimethylpyrazol-4-yl)sulfonylmethanone |
|---|---|
| PubChem CID | 160889351 |
| Molecular Formula | C19H22ClN5O4S |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | [2-chloro-6-[3-(2,2-dimethylpropoxy)pyrazol-1-yl]-3-pyridinyl]-(1,3-dimethylpyrazol-4-yl)sulfonylmethanone |
| SMILES | Cc1nn(C)cc1S(=O)(=O)C(=O)c1ccc(-n2ccc(OCC(C)(C)C)n2)nc1Cl |
| InChI | InChI=1S/C19H22ClN5O4S/c1-12-14(10-24(5)22-12)30(27,28)18(26)13-6-7-15(21-17(13)20)25-9-8-16(23-25)29-11-19(2,3)4/h6-10H,11H2,1-5H3 |
| InChIKey | JUIMWULXSUAEDX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 108.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|