C17H24ClN3O3Si — CID 153351086
ethyl 2-chloro-6-[3-(3-trimethylsilylpropoxy)pyrazol-1-yl]pyridine-3-carboxylate (PubChem CID 153351086) has the molecular formula C17H24ClN3O3Si and a molecular weight of 381.94 g/mol. Its IUPAC name is ethyl 2-chloro-6-[3-(3-trimethylsilylpropoxy)pyrazol-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 2-chloro-6-[3-(3-trimethylsilylpropoxy)pyrazol-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 153351086 |
| Molecular Formula | C17H24ClN3O3Si |
| Molecular Weight | 381.94 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | ethyl 2-chloro-6-[3-(3-trimethylsilylpropoxy)pyrazol-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(-n2ccc(OCCC[Si](C)(C)C)n2)nc1Cl |
| InChI | InChI=1S/C17H24ClN3O3Si/c1-5-23-17(22)13-7-8-14(19-16(13)18)21-10-9-15(20-21)24-11-6-12-25(2,3)4/h7-10H,5-6,11-12H2,1-4H3 |
| InChIKey | LMLAXOMNQXSAJF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.94 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|