C19H26ClN3O3S — CID 139574171
ethyl 2-chloro-6-[3-[2-[1-(trimethyl-λ4-sulfanyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxylate (PubChem CID 139574171) has the molecular formula C19H26ClN3O3S and a molecular weight of 411.96 g/mol. Its IUPAC name is ethyl 2-chloro-6-[3-[2-[1-(trimethyl-λ4-sulfanyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 2-chloro-6-[3-[2-[1-(trimethyl-λ4-sulfanyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 139574171 |
| Molecular Formula | C19H26ClN3O3S |
| Molecular Weight | 411.96 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | ethyl 2-chloro-6-[3-[2-[1-(trimethyl-λ4-sulfanyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(-n2ccc(OCCC3(S(C)(C)C)CC3)n2)nc1Cl |
| InChI | InChI=1S/C19H26ClN3O3S/c1-5-25-18(24)14-6-7-15(21-17(14)20)23-12-8-16(22-23)26-13-11-19(9-10-19)27(2,3)4/h6-8,12H,5,9-11,13H2,1-4H3 |
| InChIKey | NNCUZYAOWFMZJE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.96 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|