C19H22ClN3O3 — CID 175804253
butyl 6-[3-(1-bicyclo[1.1.1]pentanylmethoxy)pyrazol-1-yl]-2-chloropyridine-3-carboxylate (PubChem CID 175804253) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is butyl 6-[3-(1-bicyclo[1.1.1]pentanylmethoxy)pyrazol-1-yl]-2-chloropyridine-3-carboxylate.
| Compound Name | butyl 6-[3-(1-bicyclo[1.1.1]pentanylmethoxy)pyrazol-1-yl]-2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 175804253 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | butyl 6-[3-(1-bicyclo[1.1.1]pentanylmethoxy)pyrazol-1-yl]-2-chloropyridine-3-carboxylate |
| SMILES | CCCCOC(=O)c1ccc(-n2ccc(OCC34CC(C3)C4)n2)nc1Cl |
| InChI | InChI=1S/C19H22ClN3O3/c1-2-3-8-25-18(24)14-4-5-15(21-17(14)20)23-7-6-16(22-23)26-12-19-9-13(10-19)11-19/h4-7,13H,2-3,8-12H2,1H3 |
| InChIKey | XMYANCCEMIRWNW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|