C23H23ClN4O2S — CID 134398559
2-chloro-6-[3-(2,2-dicyclopropylethoxy)pyrazol-1-yl]-N-phenylsulfanylpyridine-3-carboxamide (PubChem CID 134398559) has the molecular formula C23H23ClN4O2S and a molecular weight of 454.98 g/mol. Its IUPAC name is 2-chloro-6-[3-(2,2-dicyclopropylethoxy)pyrazol-1-yl]-N-phenylsulfanylpyridine-3-carboxamide.
| Compound Name | 2-chloro-6-[3-(2,2-dicyclopropylethoxy)pyrazol-1-yl]-N-phenylsulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 134398559 |
| Molecular Formula | C23H23ClN4O2S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 2-chloro-6-[3-(2,2-dicyclopropylethoxy)pyrazol-1-yl]-N-phenylsulfanylpyridine-3-carboxamide |
| SMILES | O=C(NSc1ccccc1)c1ccc(-n2ccc(OCC(C3CC3)C3CC3)n2)nc1Cl |
| InChI | InChI=1S/C23H23ClN4O2S/c24-22-18(23(29)27-31-17-4-2-1-3-5-17)10-11-20(25-22)28-13-12-21(26-28)30-14-19(15-6-7-15)16-8-9-16/h1-5,10-13,15-16,19H,6-9,14H2,(H,27,29) |
| InChIKey | UEVNIILAELOVKC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|