C24H26ClF3N6O2S — CID 156639214
N-[[6-(butylamino)-2-pyridinyl]sulfanyl]-2-chloro-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide (PubChem CID 156639214) has the molecular formula C24H26ClF3N6O2S and a molecular weight of 555.03 g/mol. Its IUPAC name is N-[[6-(butylamino)-2-pyridinyl]sulfanyl]-2-chloro-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide.
| Compound Name | N-[[6-(butylamino)-2-pyridinyl]sulfanyl]-2-chloro-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 156639214 |
| Molecular Formula | C24H26ClF3N6O2S |
| Molecular Weight | 555.03 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | N-[[6-(butylamino)-2-pyridinyl]sulfanyl]-2-chloro-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide |
| SMILES | CCCCNc1cccc(SNC(=O)c2ccc(-n3ccc(OCCC4(C(F)(F)F)CC4)n3)nc2Cl)n1 |
| InChI | InChI=1S/C24H26ClF3N6O2S/c1-2-3-13-29-17-5-4-6-20(30-17)37-33-22(35)16-7-8-18(31-21(16)25)34-14-9-19(32-34)36-15-12-23(10-11-23)24(26,27)28/h4-9,14H,2-3,10-13,15H2,1H3,(H,29,30)(H,33,35) |
| InChIKey | WGKSIQMHBCRMEQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.03 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|