C30H37ClF3N7O2S — CID 139428365
2-chloro-N-[[6-[4-(5,5-dimethylpyrrolidin-2-yl)butylamino]-2-pyridinyl]sulfanyl]-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide (PubChem CID 139428365) has the molecular formula C30H37ClF3N7O2S and a molecular weight of 652.19 g/mol. Its IUPAC name is 2-chloro-N-[[6-[4-(5,5-dimethylpyrrolidin-2-yl)butylamino]-2-pyridinyl]sulfanyl]-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[[6-[4-(5,5-dimethylpyrrolidin-2-yl)butylamino]-2-pyridinyl]sulfanyl]-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139428365 |
| Molecular Formula | C30H37ClF3N7O2S |
| Molecular Weight | 652.19 g/mol |
| Exact Mass | 651.24 |
| IUPAC Name | 2-chloro-N-[[6-[4-(5,5-dimethylpyrrolidin-2-yl)butylamino]-2-pyridinyl]sulfanyl]-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide |
| SMILES | CC1(C)CCC(CCCCNc2cccc(SNC(=O)c3ccc(-n4ccc(OCCC5(C(F)(F)F)CC5)n4)nc3Cl)n2)N1 |
| InChI | InChI=1S/C30H37ClF3N7O2S/c1-28(2)13-11-20(38-28)6-3-4-17-35-22-7-5-8-25(36-22)44-40-27(42)21-9-10-23(37-26(21)31)41-18-12-24(39-41)43-19-16-29(14-15-29)30(32,33)34/h5,7-10,12,18,20,38H,3-4,6,11,13-17,19H2,1-2H3,(H,35,36)(H,40,42) |
| InChIKey | VAPPGBOMQBIKJR-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.19 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|