C16H16ClF3N4O4S — CID 139399973
2-chloro-3-(sulfinocarbamoyl)-6-[3-[3-[1-(trifluoromethyl)cyclopropyl]propoxy]pyrazol-1-yl]pyridine (PubChem CID 139399973) has the molecular formula C16H16ClF3N4O4S and a molecular weight of 452.84 g/mol. Its IUPAC name is 2-chloro-3-(sulfinocarbamoyl)-6-[3-[3-[1-(trifluoromethyl)cyclopropyl]propoxy]pyrazol-1-yl]pyridine.
| Compound Name | 2-chloro-3-(sulfinocarbamoyl)-6-[3-[3-[1-(trifluoromethyl)cyclopropyl]propoxy]pyrazol-1-yl]pyridine |
|---|---|
| PubChem CID | 139399973 |
| Molecular Formula | C16H16ClF3N4O4S |
| Molecular Weight | 452.84 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 2-chloro-3-(sulfinocarbamoyl)-6-[3-[3-[1-(trifluoromethyl)cyclopropyl]propoxy]pyrazol-1-yl]pyridine |
| SMILES | O=C(NS(=O)O)c1ccc(-n2ccc(OCCCC3(C(F)(F)F)CC3)n2)nc1Cl |
| InChI | InChI=1S/C16H16ClF3N4O4S/c17-13-10(14(25)23-29(26)27)2-3-11(21-13)24-8-4-12(22-24)28-9-1-5-15(6-7-15)16(18,19)20/h2-4,8H,1,5-7,9H2,(H,23,25)(H,26,27) |
| InChIKey | OJDOEHNYTGFXHI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.84 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|