C21H23ClN6O2S — CID 163792791
2-chloro-N-(1,3-dimethylpyrazol-4-yl)sulfanyl-6-[3-(spiro[2.3]hexan-6-ylmethoxy)pyrazol-1-yl]pyridine-3-carboxamide (PubChem CID 163792791) has the molecular formula C21H23ClN6O2S and a molecular weight of 458.98 g/mol. Its IUPAC name is 2-chloro-N-(1,3-dimethylpyrazol-4-yl)sulfanyl-6-[3-(spiro[2.3]hexan-6-ylmethoxy)pyrazol-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(1,3-dimethylpyrazol-4-yl)sulfanyl-6-[3-(spiro[2.3]hexan-6-ylmethoxy)pyrazol-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163792791 |
| Molecular Formula | C21H23ClN6O2S |
| Molecular Weight | 458.98 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 2-chloro-N-(1,3-dimethylpyrazol-4-yl)sulfanyl-6-[3-(spiro[2.3]hexan-6-ylmethoxy)pyrazol-1-yl]pyridine-3-carboxamide |
| SMILES | Cc1nn(C)cc1SNC(=O)c1ccc(-n2ccc(OCC3CCC34CC4)n2)nc1Cl |
| InChI | InChI=1S/C21H23ClN6O2S/c1-13-16(11-27(2)24-13)31-26-20(29)15-3-4-17(23-19(15)22)28-10-6-18(25-28)30-12-14-5-7-21(14)8-9-21/h3-4,6,10-11,14H,5,7-9,12H2,1-2H3,(H,26,29) |
| InChIKey | MYGBAZCJZGCQHD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.98 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|