C16H18ClN3O3 — CID 134393632
tert-butyl 2-chloro-6-(3-cyclopropyloxypyrazol-1-yl)pyridine-3-carboxylate (PubChem CID 134393632) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is tert-butyl 2-chloro-6-(3-cyclopropyloxypyrazol-1-yl)pyridine-3-carboxylate.
| Compound Name | tert-butyl 2-chloro-6-(3-cyclopropyloxypyrazol-1-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134393632 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | tert-butyl 2-chloro-6-(3-cyclopropyloxypyrazol-1-yl)pyridine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc(-n2ccc(OC3CC3)n2)nc1Cl |
| InChI | InChI=1S/C16H18ClN3O3/c1-16(2,3)23-15(21)11-6-7-12(18-14(11)17)20-9-8-13(19-20)22-10-4-5-10/h6-10H,4-5H2,1-3H3 |
| InChIKey | MVYUIJDRCXYUEA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|