C19H28ClN3O2Si — CID 153351097
tert-butyl 6-[3-[tert-butyl(dimethyl)silyl]pyrazol-1-yl]-2-chloropyridine-3-carboxylate (PubChem CID 153351097) has the molecular formula C19H28ClN3O2Si and a molecular weight of 393.99 g/mol. Its IUPAC name is tert-butyl 6-[3-[tert-butyl(dimethyl)silyl]pyrazol-1-yl]-2-chloropyridine-3-carboxylate.
| Compound Name | tert-butyl 6-[3-[tert-butyl(dimethyl)silyl]pyrazol-1-yl]-2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 153351097 |
| Molecular Formula | C19H28ClN3O2Si |
| Molecular Weight | 393.99 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | tert-butyl 6-[3-[tert-butyl(dimethyl)silyl]pyrazol-1-yl]-2-chloropyridine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc(-n2ccc([Si](C)(C)C(C)(C)C)n2)nc1Cl |
| InChI | InChI=1S/C19H28ClN3O2Si/c1-18(2,3)25-17(24)13-9-10-14(21-16(13)20)23-12-11-15(22-23)26(7,8)19(4,5)6/h9-12H,1-8H3 |
| InChIKey | PYYRNZYICVBGDO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.99 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|