C9H9Cl2NO3 — CID 143641342
2-hydroxypropan-2-yl 2,6-dichloropyridine-3-carboxylate (PubChem CID 143641342) has the molecular formula C9H9Cl2NO3 and a molecular weight of 250.08 g/mol. Its IUPAC name is 2-hydroxypropan-2-yl 2,6-dichloropyridine-3-carboxylate.
| Compound Name | 2-hydroxypropan-2-yl 2,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 143641342 |
| Molecular Formula | C9H9Cl2NO3 |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 2-hydroxypropan-2-yl 2,6-dichloropyridine-3-carboxylate |
| SMILES | CC(C)(O)OC(=O)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C9H9Cl2NO3/c1-9(2,14)15-8(13)5-3-4-6(10)12-7(5)11/h3-4,14H,1-2H3 |
| InChIKey | WRWVTSGVMVGJCV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|