C12H5Cl5N2O3 — CID 159765877
2,6-dichloropyridine-3-carbonyl chloride;2,6-dichloropyridine-3-carboxylic acid (PubChem CID 159765877) has the molecular formula C12H5Cl5N2O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2,6-dichloropyridine-3-carbonyl chloride;2,6-dichloropyridine-3-carboxylic acid.
| Compound Name | 2,6-dichloropyridine-3-carbonyl chloride;2,6-dichloropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 159765877 |
| Molecular Formula | C12H5Cl5N2O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 399.87 |
| IUPAC Name | 2,6-dichloropyridine-3-carbonyl chloride;2,6-dichloropyridine-3-carboxylic acid |
| SMILES | O=C(Cl)c1ccc(Cl)nc1Cl.O=C(O)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C6H2Cl3NO.C6H3Cl2NO2/c7-4-2-1-3(6(9)11)5(8)10-4;7-4-2-1-3(6(10)11)5(8)9-4/h1-2H;1-2H,(H,10,11) |
| InChIKey | NFMKNWFYXQDZCY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|