C6H4Cl2N2O — CID 22142778
2,6-dichloropyridine-3-carboxamide (PubChem CID 22142778) has the molecular formula C6H4Cl2N2O and a molecular weight of 191.02 g/mol. Its IUPAC name is 2,6-dichloropyridine-3-carboxamide.
| Compound Name | 2,6-dichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 22142778 |
| Molecular Formula | C6H4Cl2N2O |
| Molecular Weight | 191.02 g/mol |
| Exact Mass | 189.97 |
| IUPAC Name | 2,6-dichloropyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C6H4Cl2N2O/c7-4-2-1-3(6(9)11)5(8)10-4/h1-2H,(H2,9,11) |
| InChIKey | TZQZNPXAAMVOKE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.02 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|